C10H8ClN3 — CID 170467919
2-(4-chlorobut-1-ynyl)-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 170467919) has the molecular formula C10H8ClN3 and a molecular weight of 205.65 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-5H-pyrrolo[2,3-b]pyrazine.
| Compound Name | 2-(4-chlorobut-1-ynyl)-5H-pyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 170467919 |
| Molecular Formula | C10H8ClN3 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | ClCCC#Cc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C10H8ClN3/c11-5-2-1-3-8-7-13-10-9(14-8)4-6-12-10/h4,6-7H,2,5H2,(H,12,13) |
| InChIKey | GWXHDUNEQRRLFS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|