C8H5N5 — CID 67259052
6H-pyrrolo[2,3-g]pteridine (PubChem CID 67259052) has the molecular formula C8H5N5 and a molecular weight of 171.16 g/mol. Its IUPAC name is 6H-pyrrolo[2,3-g]pteridine.
| Compound Name | 6H-pyrrolo[2,3-g]pteridine |
|---|---|
| PubChem CID | 67259052 |
| Molecular Formula | C8H5N5 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 6H-pyrrolo[2,3-g]pteridine |
| SMILES | c1ncc2nc3[nH]ccc3nc2n1 |
| InChI | InChI=1S/C8H5N5/c1-2-10-7-5(1)12-8-6(13-7)3-9-4-11-8/h1-4H,(H,10,13) |
| InChIKey | PHJGZBWZNQNXAH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |