C7H5N3O3S — CID 170472706
4-(5-nitro-1,3-thiazol-2-yl)but-3-ynamide (PubChem CID 170472706) has the molecular formula C7H5N3O3S and a molecular weight of 211.20 g/mol. Its IUPAC name is 4-(5-nitro-1,3-thiazol-2-yl)but-3-ynamide.
| Compound Name | 4-(5-nitro-1,3-thiazol-2-yl)but-3-ynamide |
|---|---|
| PubChem CID | 170472706 |
| Molecular Formula | C7H5N3O3S |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 4-(5-nitro-1,3-thiazol-2-yl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C7H5N3O3S/c8-5(11)2-1-3-6-9-4-7(14-6)10(12)13/h4H,2H2,(H2,8,11) |
| InChIKey | YECANMKWOAGMSR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|