C12H10N2O2 — CID 170473258
4-(2-methyl-1,3-benzoxazol-5-yl)but-3-ynamide (PubChem CID 170473258) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-(2-methyl-1,3-benzoxazol-5-yl)but-3-ynamide.
| Compound Name | 4-(2-methyl-1,3-benzoxazol-5-yl)but-3-ynamide |
|---|---|
| PubChem CID | 170473258 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4-(2-methyl-1,3-benzoxazol-5-yl)but-3-ynamide |
| SMILES | Cc1nc2cc(C#CCC(N)=O)ccc2o1 |
| InChI | InChI=1S/C12H10N2O2/c1-8-14-10-7-9(3-2-4-12(13)15)5-6-11(10)16-8/h5-7H,4H2,1H3,(H2,13,15) |
| InChIKey | QILJBYXRKVRICY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|