C10H10Cl2FN — CID 170486757
4-(2,6-dichloro-4-fluorophenyl)but-3-en-1-amine (PubChem CID 170486757) has the molecular formula C10H10Cl2FN and a molecular weight of 234.10 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-fluorophenyl)but-3-en-1-amine.
| Compound Name | 4-(2,6-dichloro-4-fluorophenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 170486757 |
| Molecular Formula | C10H10Cl2FN |
| Molecular Weight | 234.10 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | 4-(2,6-dichloro-4-fluorophenyl)but-3-en-1-amine |
| SMILES | NCCC=Cc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H10Cl2FN/c11-9-5-7(13)6-10(12)8(9)3-1-2-4-14/h1,3,5-6H,2,4,14H2 |
| InChIKey | IYMDFFUUYYEYAG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.10 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |