C10H12Cl2N2 — CID 170487000
4-(4-aminobut-1-enyl)-3,5-dichloroaniline (PubChem CID 170487000) has the molecular formula C10H12Cl2N2 and a molecular weight of 231.13 g/mol. Its IUPAC name is 4-(4-aminobut-1-enyl)-3,5-dichloroaniline.
| Compound Name | 4-(4-aminobut-1-enyl)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 170487000 |
| Molecular Formula | C10H12Cl2N2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-(4-aminobut-1-enyl)-3,5-dichloroaniline |
| SMILES | NCCC=Cc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2/c11-9-5-7(14)6-10(12)8(9)3-1-2-4-13/h1,3,5-6H,2,4,13-14H2 |
| InChIKey | ULMKWGPXJZHKAN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|