C16H20N2O2 — CID 170489483
N-[4-(1-acetyl-2,3-dihydroindol-5-yl)but-3-enyl]acetamide (PubChem CID 170489483) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[4-(1-acetyl-2,3-dihydroindol-5-yl)but-3-enyl]acetamide.
| Compound Name | N-[4-(1-acetyl-2,3-dihydroindol-5-yl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489483 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[4-(1-acetyl-2,3-dihydroindol-5-yl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1ccc2c(c1)CCN2C(C)=O |
| InChI | InChI=1S/C16H20N2O2/c1-12(19)17-9-4-3-5-14-6-7-16-15(11-14)8-10-18(16)13(2)20/h3,5-7,11H,4,8-10H2,1-2H3,(H,17,19) |
| InChIKey | TUNUUOVLUJRBRE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|