C20H30N2O2 — CID 170491259
tert-butyl N-[4-(4-piperidin-4-ylphenyl)but-3-enyl]carbamate (PubChem CID 170491259) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl N-[4-(4-piperidin-4-ylphenyl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-piperidin-4-ylphenyl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491259 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl N-[4-(4-piperidin-4-ylphenyl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C20H30N2O2/c1-20(2,3)24-19(23)22-13-5-4-6-16-7-9-17(10-8-16)18-11-14-21-15-12-18/h4,6-10,18,21H,5,11-15H2,1-3H3,(H,22,23) |
| InChIKey | AYRKKRXMZSIVOL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|