C29H24N2O5 — CID 170493246
6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 170493246) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 170493246 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-enyl]-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(NCCC=Cc1ccc2[nH]cc(C(=O)O)c(=O)c2c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H24N2O5/c32-27-23-15-18(12-13-26(23)31-16-24(27)28(33)34)7-5-6-14-30-29(35)36-17-25-21-10-3-1-8-19(21)20-9-2-4-11-22(20)25/h1-5,7-13,15-16,25H,6,14,17H2,(H,30,35)(H,31,32)(H,33,34) |
| InChIKey | BGGFDMYKQOKOAB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|