About 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate
4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate (PubChem CID 170493778) has the molecular formula C16H15N2O4S-
and a molecular weight of 331.37 g/mol. Its IUPAC name is 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate |
| PubChem CID | 170493778 |
| Molecular Formula | C16H15N2O4S- |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate |
| SMILES | O=C(NCCC=Cc1csc(C(=O)[O-])n1)OCc1ccccc1 |
| InChI | InChI=1S/C16H16N2O4S/c19-15(20)14-18-13(11-23-14)8-4-5-9-17-16(21)22-10-12-6-2-1-3-7-12/h1-4,6-8,11H,5,9-10H2,(H,17,21)(H,19,20)/p-1 |
| InChIKey | VYRAWXXXRKKYSF-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate?
The IUPAC name of 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate (CID 170493778) is 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate.
What is the SMILES notation for 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate?
The canonical SMILES for 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate is O=C(NCCC=Cc1csc(C(=O)[O-])n1)OCc1ccccc1.
What is the InChIKey of 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate?
The InChIKey is VYRAWXXXRKKYSF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16N2O4S/c19-15(20)14-18-13(11-23-14)8-4-5-9-17-16(21)22-10-12-6-2-1-3-7-12/h1-4,6-8,11H,5,9-10H2,(H,17,21)(H,19,20)/p-1.
What are the key properties of 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate?
4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate has a molecular weight of 331.37 g/mol, XLogP of 1.84, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(phenylmethoxycarbonylamino)but-1-enyl]-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 170493778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).