C21H21N3O2S — CID 170494830
benzyl N-[4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]but-3-enyl]carbamate (PubChem CID 170494830) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is benzyl N-[4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494830 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | benzyl N-[4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]but-3-enyl]carbamate |
| SMILES | Nc1nc(-c2ccc(C=CCCNC(=O)OCc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C21H21N3O2S/c22-20-24-19(15-27-20)18-11-9-16(10-12-18)6-4-5-13-23-21(25)26-14-17-7-2-1-3-8-17/h1-4,6-12,15H,5,13-14H2,(H2,22,24)(H,23,25) |
| InChIKey | ZXZHVXIZPZMSLR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|