C18H17F3N2O2 — CID 170494425
benzyl N-[4-[4-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate (PubChem CID 170494425) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is benzyl N-[4-[4-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[4-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494425 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | benzyl N-[4-[4-(trifluoromethyl)-3-pyridinyl]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cnccc1C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C18H17F3N2O2/c19-18(20,21)16-9-11-22-12-15(16)8-4-5-10-23-17(24)25-13-14-6-2-1-3-7-14/h1-4,6-9,11-12H,5,10,13H2,(H,23,24) |
| InChIKey | VKKXPZJKQAAPRH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|