C20H19F4NO3 — CID 170494966
benzyl N-[4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-enyl]carbamate (PubChem CID 170494966) has the molecular formula C20H19F4NO3 and a molecular weight of 397.37 g/mol. Its IUPAC name is benzyl N-[4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-enyl]carbamate.
| Compound Name | benzyl N-[4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170494966 |
| Molecular Formula | C20H19F4NO3 |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | benzyl N-[4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]but-3-enyl]carbamate |
| SMILES | O=C(NCCC=Cc1cccc(OC(F)(F)C(F)F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H19F4NO3/c21-18(22)20(23,24)28-17-11-6-10-15(13-17)7-4-5-12-25-19(26)27-14-16-8-2-1-3-9-16/h1-4,6-11,13,18H,5,12,14H2,(H,25,26) |
| InChIKey | HDPAMWBGCLTWMQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|