C9H8ClF2N — CID 170498887
3-(4-chlorobut-1-enyl)-2,6-difluoropyridine (PubChem CID 170498887) has the molecular formula C9H8ClF2N and a molecular weight of 203.62 g/mol. Its IUPAC name is 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine.
| Compound Name | 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine |
|---|---|
| PubChem CID | 170498887 |
| Molecular Formula | C9H8ClF2N |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine |
| SMILES | Fc1ccc(C=CCCCl)c(F)n1 |
| InChI | InChI=1S/C9H8ClF2N/c10-6-2-1-3-7-4-5-8(11)13-9(7)12/h1,3-5H,2,6H2 |
| InChIKey | XBWTVFAXKIHSKH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|