About 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine
3-(4-chlorobut-1-enyl)-2,6-difluoropyridine (PubChem CID 170498887) has the molecular formula C9H8ClF2N
and a molecular weight of 203.62 g/mol. Its IUPAC name is 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine.
Molecular Properties
| Compound Name | 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine |
| PubChem CID | 170498887 |
| Molecular Formula | C9H8ClF2N |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine |
| SMILES | Fc1ccc(C=CCCCl)c(F)n1 |
| InChI | InChI=1S/C9H8ClF2N/c10-6-2-1-3-7-4-5-8(11)13-9(7)12/h1,3-5H,2,6H2 |
| InChIKey | XBWTVFAXKIHSKH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine?
The IUPAC name of 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine (CID 170498887) is 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine.
What is the SMILES notation for 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine?
The canonical SMILES for 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine is Fc1ccc(C=CCCCl)c(F)n1.
What is the InChIKey of 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine?
The InChIKey is XBWTVFAXKIHSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF2N/c10-6-2-1-3-7-4-5-8(11)13-9(7)12/h1,3-5H,2,6H2.
What are the key properties of 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine?
3-(4-chlorobut-1-enyl)-2,6-difluoropyridine has a molecular weight of 203.62 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorobut-1-enyl)-2,6-difluoropyridine is sourced from PubChem (CID 170498887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).