C9H10N2O3 — CID 170500342
methyl 4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoate (PubChem CID 170500342) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is methyl 4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoate.
| Compound Name | methyl 4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoate |
|---|---|
| PubChem CID | 170500342 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | methyl 4-(6-oxo-1H-pyrimidin-5-yl)but-3-enoate |
| SMILES | COC(=O)CC=Cc1cnc[nH]c1=O |
| InChI | InChI=1S/C9H10N2O3/c1-14-8(12)4-2-3-7-5-10-6-11-9(7)13/h2-3,5-6H,4H2,1H3,(H,10,11,13) |
| InChIKey | QCGGJNSOGKJHBO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |