C19H21FN2O4 — CID 170507977
N-(5-carbamoyl-2-fluorophenyl)-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide (PubChem CID 170507977) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is N-(5-carbamoyl-2-fluorophenyl)-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide.
| Compound Name | N-(5-carbamoyl-2-fluorophenyl)-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide |
|---|---|
| PubChem CID | 170507977 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-(5-carbamoyl-2-fluorophenyl)-4-methyl-2-oxo-6-pentan-2-ylpyran-3-carboxamide |
| SMILES | CCCC(C)c1cc(C)c(C(=O)Nc2cc(C(N)=O)ccc2F)c(=O)o1 |
| InChI | InChI=1S/C19H21FN2O4/c1-4-5-10(2)15-8-11(3)16(19(25)26-15)18(24)22-14-9-12(17(21)23)6-7-13(14)20/h6-10H,4-5H2,1-3H3,(H2,21,23)(H,22,24) |
| InChIKey | KMTIXAFDCRWQBD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |