C19H23N3O6S — CID 170510083
(3aS,6aS)-N-(cyclopropylmethyl)-5-[5-(3-methyl-1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 170510083) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is (3aS,6aS)-N-(cyclopropylmethyl)-5-[5-(3-methyl-1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,6aS)-N-(cyclopropylmethyl)-5-[5-(3-methyl-1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 170510083 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (3aS,6aS)-N-(cyclopropylmethyl)-5-[5-(3-methyl-1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)N3C[C@H]4COC[C@@]4(C(=O)NCC4CC4)C3)o2)on1 |
| InChI | InChI=1S/C19H23N3O6S/c1-12-6-16(28-21-12)15-4-5-17(27-15)29(24,25)22-8-14-9-26-11-19(14,10-22)18(23)20-7-13-2-3-13/h4-6,13-14H,2-3,7-11H2,1H3,(H,20,23)/t14-,19-/m0/s1 |
| InChIKey | UPFAUQFRMRHQDZ-LIRRHRJNSA-N |
| XLogP | 1.41 |
| TPSA | 114.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |