C21H33N3O4 — CID 170510655
1-[3-[[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 170510655) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-[3-[[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 170510655 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-[3-[[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(CCC(C)C)oc(=O)c1C(=O)NCCCN1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C21H33N3O4/c1-14(2)7-8-17-12-15(3)18(21(27)28-17)20(26)23-9-5-11-24-10-4-6-16(13-24)19(22)25/h12,14,16H,4-11,13H2,1-3H3,(H2,22,25)(H,23,26) |
| InChIKey | CXIJZRQNOSMFKT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|