C17H23NO5 — CID 171387225
methyl 1-[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]azetidine-3-carboxylate (PubChem CID 171387225) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl 1-[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 171387225 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | methyl 1-[4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carbonyl]azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2c(C)cc(CCC(C)C)oc2=O)C1 |
| InChI | InChI=1S/C17H23NO5/c1-10(2)5-6-13-7-11(3)14(17(21)23-13)15(19)18-8-12(9-18)16(20)22-4/h7,10,12H,5-6,8-9H2,1-4H3 |
| InChIKey | DAWPAQWJHXJQDM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |