C15H22N2O4 — CID 169413200
N-[(2S)-1-amino-1-oxopropan-2-yl]-4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carboxamide (PubChem CID 169413200) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxopropan-2-yl]-4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carboxamide.
| Compound Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 169413200 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[(2S)-1-amino-1-oxopropan-2-yl]-4-methyl-6-(3-methylbutyl)-2-oxopyran-3-carboxamide |
| SMILES | Cc1cc(CCC(C)C)oc(=O)c1C(=O)N[C@@H](C)C(N)=O |
| InChI | InChI=1S/C15H22N2O4/c1-8(2)5-6-11-7-9(3)12(15(20)21-11)14(19)17-10(4)13(16)18/h7-8,10H,5-6H2,1-4H3,(H2,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | WCUNAPKRGQSYBO-JTQLQIEISA-N |
| XLogP | 1.14 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |