C17H24N2O4 — CID 170512843
4-methyl-6-(3-methylbutyl)-2-oxo-N-[(5-oxopyrrolidin-2-yl)methyl]pyran-3-carboxamide (PubChem CID 170512843) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-methyl-6-(3-methylbutyl)-2-oxo-N-[(5-oxopyrrolidin-2-yl)methyl]pyran-3-carboxamide.
| Compound Name | 4-methyl-6-(3-methylbutyl)-2-oxo-N-[(5-oxopyrrolidin-2-yl)methyl]pyran-3-carboxamide |
|---|---|
| PubChem CID | 170512843 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-methyl-6-(3-methylbutyl)-2-oxo-N-[(5-oxopyrrolidin-2-yl)methyl]pyran-3-carboxamide |
| SMILES | Cc1cc(CCC(C)C)oc(=O)c1C(=O)NCC1CCC(=O)N1 |
| InChI | InChI=1S/C17H24N2O4/c1-10(2)4-6-13-8-11(3)15(17(22)23-13)16(21)18-9-12-5-7-14(20)19-12/h8,10,12H,4-7,9H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | QTBRTICLQANXBU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |