C26H24NO+ — CID 170517260
4-(4-tert-butylnaphthalen-2-yl)-1-methyl-[1]benzofuro[3,2-b]pyridin-1-ium (PubChem CID 170517260) has the molecular formula C26H24NO+ and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-(4-tert-butylnaphthalen-2-yl)-1-methyl-[1]benzofuro[3,2-b]pyridin-1-ium.
| Compound Name | 4-(4-tert-butylnaphthalen-2-yl)-1-methyl-[1]benzofuro[3,2-b]pyridin-1-ium |
|---|---|
| PubChem CID | 170517260 |
| Molecular Formula | C26H24NO+ |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-(4-tert-butylnaphthalen-2-yl)-1-methyl-[1]benzofuro[3,2-b]pyridin-1-ium |
| SMILES | C[n+]1ccc(-c2cc(C(C)(C)C)c3ccccc3c2)c2oc3ccccc3c21 |
| InChI | InChI=1S/C26H24NO/c1-26(2,3)22-16-18(15-17-9-5-6-10-19(17)22)20-13-14-27(4)24-21-11-7-8-12-23(21)28-25(20)24/h5-16H,1-4H3/q+1 |
| InChIKey | SROVGJPDEGAONI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|