C18H29N — CID 170522826
(1S)-1,7,8-trimethyl-4,5-di(propan-2-yl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 170522826) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (1S)-1,7,8-trimethyl-4,5-di(propan-2-yl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1S)-1,7,8-trimethyl-4,5-di(propan-2-yl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 170522826 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (1S)-1,7,8-trimethyl-4,5-di(propan-2-yl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1cc(C(C)C)c2c(c1C)[C@H](C)NCC2C(C)C |
| InChI | InChI=1S/C18H29N/c1-10(2)15-8-12(5)13(6)17-14(7)19-9-16(11(3)4)18(15)17/h8,10-11,14,16,19H,9H2,1-7H3/t14-,16?/m0/s1 |
| InChIKey | IHVDDZVMOLQMND-LBAUFKAWSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |