C20H32S — CID 170522482
(2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydro-1-benzothiepine (PubChem CID 170522482) has the molecular formula C20H32S and a molecular weight of 304.54 g/mol. Its IUPAC name is (2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydro-1-benzothiepine.
| Compound Name | (2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydro-1-benzothiepine |
|---|---|
| PubChem CID | 170522482 |
| Molecular Formula | C20H32S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2R,3R)-2,3,8,9-tetramethyl-5,6-di(propan-2-yl)-2,3,4,5-tetrahydro-1-benzothiepine |
| SMILES | Cc1cc(C(C)C)c2c(c1C)S[C@H](C)[C@H](C)CC2C(C)C |
| InChI | InChI=1S/C20H32S/c1-11(2)17-9-13(5)15(7)20-19(17)18(12(3)4)10-14(6)16(8)21-20/h9,11-12,14,16,18H,10H2,1-8H3/t14-,16-,18?/m1/s1 |
| InChIKey | XAQMFHVHJZKCKO-CMCURQENSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |