C22H36O — CID 150844320
2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]cyclohexan-1-ol (PubChem CID 150844320) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]cyclohexan-1-ol.
| Compound Name | 2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 150844320 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 2-methyl-4-[2,4,6-tri(propan-2-yl)phenyl]cyclohexan-1-ol |
| SMILES | CC(C)c1cc(C(C)C)c(C2CCC(O)C(C)C2)c(C(C)C)c1 |
| InChI | InChI=1S/C22H36O/c1-13(2)18-11-19(14(3)4)22(20(12-18)15(5)6)17-8-9-21(23)16(7)10-17/h11-17,21,23H,8-10H2,1-7H3 |
| InChIKey | KOQYFEKWISHMHJ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |