C23H37N — CID 170522543
(1S,3R,4Z)-1,2,3,4,9,10-hexamethyl-6,7-di(propan-2-yl)-3,6-dihydro-1H-2-benzazocine (PubChem CID 170522543) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is (1S,3R,4Z)-1,2,3,4,9,10-hexamethyl-6,7-di(propan-2-yl)-3,6-dihydro-1H-2-benzazocine.
| Compound Name | (1S,3R,4Z)-1,2,3,4,9,10-hexamethyl-6,7-di(propan-2-yl)-3,6-dihydro-1H-2-benzazocine |
|---|---|
| PubChem CID | 170522543 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | (1S,3R,4Z)-1,2,3,4,9,10-hexamethyl-6,7-di(propan-2-yl)-3,6-dihydro-1H-2-benzazocine |
| SMILES | C/C1=C/C(C(C)C)c2c(C(C)C)cc(C)c(C)c2[C@H](C)N(C)[C@@H]1C |
| InChI | InChI=1S/C23H37N/c1-13(2)20-11-15(5)17(7)22-19(9)24(10)18(8)16(6)12-21(14(3)4)23(20)22/h11-14,18-19,21H,1-10H3/b16-12-/t18-,19+,21?/m1/s1 |
| InChIKey | VKFUORPHJPMOIL-YNBNHABCSA-N |
| XLogP | 6.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|