About [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane
[(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane (PubChem CID 170523949) has the molecular formula C9H16Si
and a molecular weight of 152.31 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane |
| PubChem CID | 170523949 |
| Molecular Formula | C9H16Si |
| Molecular Weight | 152.31 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane |
| SMILES | C=C/C=C(\C=C)[Si](C)(C)C |
| InChI | InChI=1S/C9H16Si/c1-6-8-9(7-2)10(3,4)5/h6-8H,1-2H2,3-5H3/b9-8+ |
| InChIKey | ZPTBLYUWCJRXCM-CMDGGOBGSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane?
The IUPAC name of [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane (CID 170523949) is [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane.
What is the SMILES notation for [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane?
The canonical SMILES for [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane is C=C/C=C(\C=C)[Si](C)(C)C.
What is the InChIKey of [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane?
The InChIKey is ZPTBLYUWCJRXCM-CMDGGOBGSA-N. The full InChI is InChI=1S/C9H16Si/c1-6-8-9(7-2)10(3,4)5/h6-8H,1-2H2,3-5H3/b9-8+.
What are the key properties of [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane?
[(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane has a molecular weight of 152.31 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-hexa-1,3,5-trien-3-yl]-trimethylsilane is sourced from PubChem (CID 170523949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).