C19H19N3O4S — CID 17052516
N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]thiophene-2-carboxamide (PubChem CID 17052516) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17052516 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[5-[(1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl)methyl]-2-methoxyphenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C3CCCN3C2=O)cc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C19H19N3O4S/c1-26-15-7-6-12(10-13(15)20-17(23)16-5-3-9-27-16)11-22-18(24)14-4-2-8-21(14)19(22)25/h3,5-7,9-10,14H,2,4,8,11H2,1H3,(H,20,23) |
| InChIKey | URRUJJXUXMQXPO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|