C22H30N2O3S — CID 26345069
N-[3-[2-methoxy-4-[[(3S)-3-methylpiperidin-1-yl]methyl]phenoxy]propyl]thiophene-2-carboxamide (PubChem CID 26345069) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[3-[2-methoxy-4-[[(3S)-3-methylpiperidin-1-yl]methyl]phenoxy]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[2-methoxy-4-[[(3S)-3-methylpiperidin-1-yl]methyl]phenoxy]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26345069 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[3-[2-methoxy-4-[[(3S)-3-methylpiperidin-1-yl]methyl]phenoxy]propyl]thiophene-2-carboxamide |
| SMILES | COc1cc(CN2CCC[C@H](C)C2)ccc1OCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C22H30N2O3S/c1-17-6-3-11-24(15-17)16-18-8-9-19(20(14-18)26-2)27-12-5-10-23-22(25)21-7-4-13-28-21/h4,7-9,13-14,17H,3,5-6,10-12,15-16H2,1-2H3,(H,23,25)/t17-/m0/s1 |
| InChIKey | WCOKROSCDJIRSM-KRWDZBQOSA-N |
| XLogP | 4.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|