C32H36 — CID 170526583
2-[4-[5-(3-cyclopentylpropyl)-3aH-inden-2-yl]but-1-en-2-yl]-4-methylidene-4aH-naphthalene (PubChem CID 170526583) has the molecular formula C32H36 and a molecular weight of 420.64 g/mol. Its IUPAC name is 2-[4-[5-(3-cyclopentylpropyl)-3aH-inden-2-yl]but-1-en-2-yl]-4-methylidene-4aH-naphthalene.
| Compound Name | 2-[4-[5-(3-cyclopentylpropyl)-3aH-inden-2-yl]but-1-en-2-yl]-4-methylidene-4aH-naphthalene |
|---|---|
| PubChem CID | 170526583 |
| Molecular Formula | C32H36 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 2-[4-[5-(3-cyclopentylpropyl)-3aH-inden-2-yl]but-1-en-2-yl]-4-methylidene-4aH-naphthalene |
| SMILES | C=C(CCC1=CC2C=C(CCCC3CCCC3)C=CC2=C1)C1=CC(=C)C2C=CC=CC2=C1 |
| InChI | InChI=1S/C32H36/c1-23(30-18-24(2)32-13-6-5-12-29(32)22-30)14-15-27-20-28-17-16-26(19-31(28)21-27)11-7-10-25-8-3-4-9-25/h5-6,12-13,16-22,25,31-32H,1-4,7-11,14-15H2 |
| InChIKey | QZKFONGARMEEFJ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |