C30H27OPt- — CID 170529068
2,4-di(propan-2-yl)spiro[3,4-dihydrobenzo[f][1]benzofuran-3-ide-9,9'-fluorene];platinum (PubChem CID 170529068) has the molecular formula C30H27OPt- and a molecular weight of 598.62 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)spiro[3,4-dihydrobenzo[f][1]benzofuran-3-ide-9,9'-fluorene];platinum.
| Compound Name | 2,4-di(propan-2-yl)spiro[3,4-dihydrobenzo[f][1]benzofuran-3-ide-9,9'-fluorene];platinum |
|---|---|
| PubChem CID | 170529068 |
| Molecular Formula | C30H27OPt- |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2,4-di(propan-2-yl)spiro[3,4-dihydrobenzo[f][1]benzofuran-3-ide-9,9'-fluorene];platinum |
| SMILES | CC(C)c1[c-]c2c(o1)C1(c3ccccc3-c3ccccc31)c1ccccc1C2C(C)C.[Pt] |
| InChI | InChI=1S/C30H27O.Pt/c1-18(2)27-17-23-28(19(3)4)22-13-7-10-16-26(22)30(29(23)31-27)24-14-8-5-11-20(24)21-12-6-9-15-25(21)30;/h5-16,18-19,28H,1-4H3;/q-1; |
| InChIKey | QBFKHBKUTROBMO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|