C26H22NO2P — CID 148962083
4'-oxo-4'-propan-2-ylspiro[fluorene-9,9'-phosphinolino[3,2-b]furan]-3'-amine (PubChem CID 148962083) has the molecular formula C26H22NO2P and a molecular weight of 411.44 g/mol. Its IUPAC name is 4'-oxo-4'-propan-2-ylspiro[fluorene-9,9'-phosphinolino[3,2-b]furan]-3'-amine.
| Compound Name | 4'-oxo-4'-propan-2-ylspiro[fluorene-9,9'-phosphinolino[3,2-b]furan]-3'-amine |
|---|---|
| PubChem CID | 148962083 |
| Molecular Formula | C26H22NO2P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4'-oxo-4'-propan-2-ylspiro[fluorene-9,9'-phosphinolino[3,2-b]furan]-3'-amine |
| SMILES | CC(C)P1(=O)c2ccccc2C2(c3ccccc3-c3ccccc32)c2occ(N)c21 |
| InChI | InChI=1S/C26H22NO2P/c1-16(2)30(28)23-14-8-7-13-21(23)26(25-24(30)22(27)15-29-25)19-11-5-3-9-17(19)18-10-4-6-12-20(18)26/h3-16H,27H2,1-2H3 |
| InChIKey | PSAAIOFGVGARER-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|