C18H22NO2PS — CID 126670409
5,10-dioxo-2,10-di(propan-2-yl)benzo[b][1,4]benzothiaphosphinin-1-amine (PubChem CID 126670409) has the molecular formula C18H22NO2PS and a molecular weight of 347.42 g/mol. Its IUPAC name is 5,10-dioxo-2,10-di(propan-2-yl)benzo[b][1,4]benzothiaphosphinin-1-amine.
| Compound Name | 5,10-dioxo-2,10-di(propan-2-yl)benzo[b][1,4]benzothiaphosphinin-1-amine |
|---|---|
| PubChem CID | 126670409 |
| Molecular Formula | C18H22NO2PS |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 5,10-dioxo-2,10-di(propan-2-yl)benzo[b][1,4]benzothiaphosphinin-1-amine |
| SMILES | CC(C)c1ccc2c(c1N)P(=O)(C(C)C)c1ccccc1S2=O |
| InChI | InChI=1S/C18H22NO2PS/c1-11(2)13-9-10-16-18(17(13)19)22(20,12(3)4)14-7-5-6-8-15(14)23(16)21/h5-12H,19H2,1-4H3 |
| InChIKey | MYIQWJPJURKZHR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|