C16H20NO3P — CID 134213961
4-oxo-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzoxaphosphinin-3-amine (PubChem CID 134213961) has the molecular formula C16H20NO3P and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-oxo-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzoxaphosphinin-3-amine.
| Compound Name | 4-oxo-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzoxaphosphinin-3-amine |
|---|---|
| PubChem CID | 134213961 |
| Molecular Formula | C16H20NO3P |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-oxo-2,4-di(propan-2-yl)furo[2,3-b][1,4]benzoxaphosphinin-3-amine |
| SMILES | CC(C)c1oc2c(c1N)P(=O)(C(C)C)c1ccccc1O2 |
| InChI | InChI=1S/C16H20NO3P/c1-9(2)14-13(17)15-16(20-14)19-11-7-5-6-8-12(11)21(15,18)10(3)4/h5-10H,17H2,1-4H3 |
| InChIKey | QGMWRYLSRJENPF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|