C27H31OP — CID 134402630
10,10-dimethyl-4-phenyl-3,5-di(propan-2-yl)acridophosphine 5-oxide (PubChem CID 134402630) has the molecular formula C27H31OP and a molecular weight of 402.52 g/mol. Its IUPAC name is 10,10-dimethyl-4-phenyl-3,5-di(propan-2-yl)acridophosphine 5-oxide.
| Compound Name | 10,10-dimethyl-4-phenyl-3,5-di(propan-2-yl)acridophosphine 5-oxide |
|---|---|
| PubChem CID | 134402630 |
| Molecular Formula | C27H31OP |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 10,10-dimethyl-4-phenyl-3,5-di(propan-2-yl)acridophosphine 5-oxide |
| SMILES | CC(C)c1ccc2c(c1-c1ccccc1)P(=O)(C(C)C)c1ccccc1C2(C)C |
| InChI | InChI=1S/C27H31OP/c1-18(2)21-16-17-23-26(25(21)20-12-8-7-9-13-20)29(28,19(3)4)24-15-11-10-14-22(24)27(23,5)6/h7-19H,1-6H3 |
| InChIKey | ROVWICIVDFBWPJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|