C22H23F3N8O — CID 170529359
6-[[(Z)-3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-9,10-dimethyl-1,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-12-one (PubChem CID 170529359) has the molecular formula C22H23F3N8O and a molecular weight of 472.48 g/mol. Its IUPAC name is 6-[[(Z)-3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-9,10-dimethyl-1,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-12-one.
| Compound Name | 6-[[(Z)-3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-9,10-dimethyl-1,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-12-one |
|---|---|
| PubChem CID | 170529359 |
| Molecular Formula | C22H23F3N8O |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 6-[[(Z)-3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-9,10-dimethyl-1,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-12-one |
| SMILES | CC1CC(=O)n2ccc3nc(NCC(=C/N)/C=N/Cc4ccc(C(F)(F)F)nc4)nc(c32)N1C |
| InChI | InChI=1S/C22H23F3N8O/c1-13-7-18(34)33-6-5-16-19(33)20(32(13)2)31-21(30-16)29-12-15(8-26)10-27-9-14-3-4-17(28-11-14)22(23,24)25/h3-6,8,10-11,13H,7,9,12,26H2,1-2H3,(H,29,30,31)/b15-8+,27-10+ |
| InChIKey | HCSIXCJZQXSPTP-CDIFUUCKSA-N |
| XLogP | 3.24 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|