C20H23N5 — CID 170533413
4-(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine (PubChem CID 170533413) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine.
| Compound Name | 4-(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 170533413 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 4-(2,4,4-trimethyl-1,3-dihydroisoquinolin-7-yl)quinazoline-2,5-diamine |
| SMILES | CN1Cc2cc(-c3nc(N)nc4cccc(N)c34)ccc2C(C)(C)C1 |
| InChI | InChI=1S/C20H23N5/c1-20(2)11-25(3)10-13-9-12(7-8-14(13)20)18-17-15(21)5-4-6-16(17)23-19(22)24-18/h4-9H,10-11,21H2,1-3H3,(H2,22,23,24) |
| InChIKey | SNTRZAVDQUURPI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|