C14H13N5 — CID 163290769
4-(2-methyl-3-pyridinyl)quinazoline-2,5-diamine (PubChem CID 163290769) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-(2-methyl-3-pyridinyl)quinazoline-2,5-diamine.
| Compound Name | 4-(2-methyl-3-pyridinyl)quinazoline-2,5-diamine |
|---|---|
| PubChem CID | 163290769 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(2-methyl-3-pyridinyl)quinazoline-2,5-diamine |
| SMILES | Cc1ncccc1-c1nc(N)nc2cccc(N)c12 |
| InChI | InChI=1S/C14H13N5/c1-8-9(4-3-7-17-8)13-12-10(15)5-2-6-11(12)18-14(16)19-13/h2-7H,15H2,1H3,(H2,16,18,19) |
| InChIKey | FWWNGWPYCFGUQJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|