C18H23N5O — CID 122510175
N-methylmethanamine;5-propoxy-4-pyridin-3-ylquinazolin-2-amine (PubChem CID 122510175) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-methylmethanamine;5-propoxy-4-pyridin-3-ylquinazolin-2-amine.
| Compound Name | N-methylmethanamine;5-propoxy-4-pyridin-3-ylquinazolin-2-amine |
|---|---|
| PubChem CID | 122510175 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-methylmethanamine;5-propoxy-4-pyridin-3-ylquinazolin-2-amine |
| SMILES | CCCOc1cccc2nc(N)nc(-c3cccnc3)c12.CNC |
| InChI | InChI=1S/C16H16N4O.C2H7N/c1-2-9-21-13-7-3-6-12-14(13)15(20-16(17)19-12)11-5-4-8-18-10-11;1-3-2/h3-8,10H,2,9H2,1H3,(H2,17,19,20);3H,1-2H3 |
| InChIKey | KRZOYCCUTWYECO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |