About potassium;phenylmethanone;sulfanide
potassium;phenylmethanone;sulfanide (PubChem CID 170539885) has the molecular formula C7H6KOS-
and a molecular weight of 177.29 g/mol. Its IUPAC name is potassium;phenylmethanone;sulfanide.
Molecular Properties
| Compound Name | potassium;phenylmethanone;sulfanide |
| PubChem CID | 170539885 |
| Molecular Formula | C7H6KOS- |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 176.98 |
| IUPAC Name | potassium;phenylmethanone;sulfanide |
| SMILES | O=[C-]c1ccccc1.[K+].[SH-] |
| InChI | InChI=1S/C7H5O.K.H2S/c8-6-7-4-2-1-3-5-7;;/h1-5H;;1H2/q-1;+1;/p-1 |
| InChIKey | MFKWFYARQQNDOY-UHFFFAOYSA-M |
| XLogP | -2.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;phenylmethanone;sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;phenylmethanone;sulfanide?
The IUPAC name of potassium;phenylmethanone;sulfanide (CID 170539885) is potassium;phenylmethanone;sulfanide.
What is the SMILES notation for potassium;phenylmethanone;sulfanide?
The canonical SMILES for potassium;phenylmethanone;sulfanide is O=[C-]c1ccccc1.[K+].[SH-].
What is the InChIKey of potassium;phenylmethanone;sulfanide?
The InChIKey is MFKWFYARQQNDOY-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5O.K.H2S/c8-6-7-4-2-1-3-5-7;;/h1-5H;;1H2/q-1;+1;/p-1.
What are the key properties of potassium;phenylmethanone;sulfanide?
potassium;phenylmethanone;sulfanide has a molecular weight of 177.29 g/mol, XLogP of -2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;phenylmethanone;sulfanide is sourced from PubChem (CID 170539885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).