About chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone
chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone (PubChem CID 4212516) has the molecular formula C8H4ClCoO2
and a molecular weight of 226.50 g/mol. Its IUPAC name is chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone.
Molecular Properties
| Compound Name | chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone |
| PubChem CID | 4212516 |
| Molecular Formula | C8H4ClCoO2 |
| Molecular Weight | 226.50 g/mol |
| Exact Mass | 225.92 |
| IUPAC Name | chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone |
| SMILES | Cl[Co+2].O=[C-]c1ccccc1[C-]=O |
| InChI | InChI=1S/C8H4O2.ClH.Co/c9-5-7-3-1-2-4-8(7)6-10;;/h1-4H;1H;/q-2;;+3/p-1 |
| InChIKey | NFSLXVBJTVZNTP-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone?
The IUPAC name of chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone (CID 4212516) is chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone.
What is the SMILES notation for chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone?
The canonical SMILES for chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone is Cl[Co+2].O=[C-]c1ccccc1[C-]=O.
What is the InChIKey of chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone?
The InChIKey is NFSLXVBJTVZNTP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H4O2.ClH.Co/c9-5-7-3-1-2-4-8(7)6-10;;/h1-4H;1H;/q-2;;+3/p-1.
What are the key properties of chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone?
chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone has a molecular weight of 226.50 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorocobalt(2+);[2-(oxomethyl)phenyl]methanone is sourced from PubChem (CID 4212516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).