C31H30BNO — CID 170541020
3,4,5,6,9,10,11-heptamethyl-13-phenoxy-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 170541020) has the molecular formula C31H30BNO and a molecular weight of 443.40 g/mol. Its IUPAC name is 3,4,5,6,9,10,11-heptamethyl-13-phenoxy-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 3,4,5,6,9,10,11-heptamethyl-13-phenoxy-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 170541020 |
| Molecular Formula | C31H30BNO |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 3,4,5,6,9,10,11-heptamethyl-13-phenoxy-1-aza-13-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | Cc1c(C)c(C)c2c(c1C)c1c(C)c(C)c(C)c3c1n2-c1ccccc1B3Oc1ccccc1 |
| InChI | InChI=1S/C31H30BNO/c1-17-18(2)23(7)30-27(20(17)4)28-21(5)19(3)22(6)29-31(28)33(30)26-16-12-11-15-25(26)32(29)34-24-13-9-8-10-14-24/h8-16H,1-7H3 |
| InChIKey | ZRYIQPWYFKUUNT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|