C19H15Cl2F3N4O2 — CID 170547054
N'-[3-[1-(3,4-dichlorophenyl)propan-2-yl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate (PubChem CID 170547054) has the molecular formula C19H15Cl2F3N4O2 and a molecular weight of 459.26 g/mol. Its IUPAC name is N'-[3-[1-(3,4-dichlorophenyl)propan-2-yl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate.
| Compound Name | N'-[3-[1-(3,4-dichlorophenyl)propan-2-yl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
|---|---|
| PubChem CID | 170547054 |
| Molecular Formula | C19H15Cl2F3N4O2 |
| Molecular Weight | 459.26 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | N'-[3-[1-(3,4-dichlorophenyl)propan-2-yl]oxadiazol-3-ium-5-yl]-N-[3-(trifluoromethyl)phenyl]carbamimidate |
| SMILES | CC(Cc1ccc(Cl)c(Cl)c1)[n+]1cc(/N=C(\[O-])Nc2cccc(C(F)(F)F)c2)on1 |
| InChI | InChI=1S/C19H15Cl2F3N4O2/c1-11(7-12-5-6-15(20)16(21)8-12)28-10-17(30-27-28)26-18(29)25-14-4-2-3-13(9-14)19(22,23)24/h2-6,8-11H,7H2,1H3,(H-,25,26,27,29) |
| InChIKey | ZHJNBXALTYWBNF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.26 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|