C20H21NO4 — CID 170555687
4-(1,3-dihydroxyisoindol-2-yl)-2-methyl-5-phenylpentanoic acid (PubChem CID 170555687) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 4-(1,3-dihydroxyisoindol-2-yl)-2-methyl-5-phenylpentanoic acid.
| Compound Name | 4-(1,3-dihydroxyisoindol-2-yl)-2-methyl-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 170555687 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 4-(1,3-dihydroxyisoindol-2-yl)-2-methyl-5-phenylpentanoic acid |
| SMILES | CC(CC(Cc1ccccc1)n1c(O)c2ccccc2c1O)C(=O)O |
| InChI | InChI=1S/C20H21NO4/c1-13(20(24)25)11-15(12-14-7-3-2-4-8-14)21-18(22)16-9-5-6-10-17(16)19(21)23/h2-10,13,15,22-23H,11-12H2,1H3,(H,24,25) |
| InChIKey | VXDWDMTZABWNRF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |