C16H8Br2OS — CID 170556363
3,10-dibromonaphtho[2,1-b][1]benzothiole 7-oxide (PubChem CID 170556363) has the molecular formula C16H8Br2OS and a molecular weight of 408.11 g/mol. Its IUPAC name is 3,10-dibromonaphtho[2,1-b][1]benzothiole 7-oxide.
| Compound Name | 3,10-dibromonaphtho[2,1-b][1]benzothiole 7-oxide |
|---|---|
| PubChem CID | 170556363 |
| Molecular Formula | C16H8Br2OS |
| Molecular Weight | 408.11 g/mol |
| Exact Mass | 405.87 |
| IUPAC Name | 3,10-dibromonaphtho[2,1-b][1]benzothiole 7-oxide |
| SMILES | O=S1c2ccc(Br)cc2-c2c1ccc1cc(Br)ccc21 |
| InChI | InChI=1S/C16H8Br2OS/c17-10-2-4-12-9(7-10)1-5-15-16(12)13-8-11(18)3-6-14(13)20(15)19/h1-8H |
| InChIKey | AFBSCYNTXRBDJE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.11 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |