C9H8Br2FNO2S — CID 170556519
N-(3,5-dibromo-4-fluorophenyl)cyclopropanesulfonamide (PubChem CID 170556519) has the molecular formula C9H8Br2FNO2S and a molecular weight of 373.04 g/mol. Its IUPAC name is N-(3,5-dibromo-4-fluorophenyl)cyclopropanesulfonamide.
| Compound Name | N-(3,5-dibromo-4-fluorophenyl)cyclopropanesulfonamide |
|---|---|
| PubChem CID | 170556519 |
| Molecular Formula | C9H8Br2FNO2S |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.86 |
| IUPAC Name | N-(3,5-dibromo-4-fluorophenyl)cyclopropanesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Br)c(F)c(Br)c1)C1CC1 |
| InChI | InChI=1S/C9H8Br2FNO2S/c10-7-3-5(4-8(11)9(7)12)13-16(14,15)6-1-2-6/h3-4,6,13H,1-2H2 |
| InChIKey | WBZQDFNDKMLHHV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|