C14H14FNO3 — CID 170560129
1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-2-methylpyridin-4-one (PubChem CID 170560129) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-2-methylpyridin-4-one.
| Compound Name | 1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-2-methylpyridin-4-one |
|---|---|
| PubChem CID | 170560129 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-2-methylpyridin-4-one |
| SMILES | Cc1c(O)c(=O)ccn1C[C@H](O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H14FNO3/c1-9-14(19)12(17)5-6-16(9)8-13(18)10-3-2-4-11(15)7-10/h2-7,13,18-19H,8H2,1H3/t13-/m0/s1 |
| InChIKey | OCGNVLKFRXWWKC-ZDUSSCGKSA-N |
| XLogP | 1.74 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |