C17H21FN2O3 — CID 94385395
3-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 94385395) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 3-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 94385395 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(C[C@H](O)c2cccc(F)c2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C17H21FN2O3/c1-19-16(23)20(15(22)17(19)8-3-2-4-9-17)11-14(21)12-6-5-7-13(18)10-12/h5-7,10,14,21H,2-4,8-9,11H2,1H3/t14-/m0/s1 |
| InChIKey | IUGBBVKRRKPREC-AWEZNQCLSA-N |
| XLogP | 2.46 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|