C15H11ClF6N2O5S2 — CID 170561730
bis(trifluoromethylsulfonyl)azanide;1-[1-(4-chlorophenyl)ethenoxy]pyridin-1-ium (PubChem CID 170561730) has the molecular formula C15H11ClF6N2O5S2 and a molecular weight of 512.84 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-[1-(4-chlorophenyl)ethenoxy]pyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-[1-(4-chlorophenyl)ethenoxy]pyridin-1-ium |
|---|---|
| PubChem CID | 170561730 |
| Molecular Formula | C15H11ClF6N2O5S2 |
| Molecular Weight | 512.84 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-[1-(4-chlorophenyl)ethenoxy]pyridin-1-ium |
| SMILES | C=C(O[n+]1ccccc1)c1ccc(Cl)cc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H11ClNO.C2F6NO4S2/c1-11(12-5-7-13(14)8-6-12)16-15-9-3-2-4-10-15;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2-10H,1H2;/q+1;-1 |
| InChIKey | QKPURGFDQGHYJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 95.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|