C16H32O3 — CID 170562371
(E)-1-ethoxy-2,4,7,9-tetramethyldec-5-ene-4,7-diol (PubChem CID 170562371) has the molecular formula C16H32O3 and a molecular weight of 272.43 g/mol. Its IUPAC name is (E)-1-ethoxy-2,4,7,9-tetramethyldec-5-ene-4,7-diol.
| Compound Name | (E)-1-ethoxy-2,4,7,9-tetramethyldec-5-ene-4,7-diol |
|---|---|
| PubChem CID | 170562371 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | (E)-1-ethoxy-2,4,7,9-tetramethyldec-5-ene-4,7-diol |
| SMILES | CCOCC(C)CC(C)(O)/C=C/C(C)(O)CC(C)C |
| InChI | InChI=1S/C16H32O3/c1-7-19-12-14(4)11-16(6,18)9-8-15(5,17)10-13(2)3/h8-9,13-14,17-18H,7,10-12H2,1-6H3/b9-8+ |
| InChIKey | DBEZSXSMLITYKR-CMDGGOBGSA-N |
| XLogP | 3.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|